Carboxylic acids and derivatives
Filtered Search Results
MilliporeSigma™ EGTA, OmniPur™, Calbiochem™,
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
MilliporeSigma™ Calbiochem™ OmniPur™ EDTA, Disodium Salt Dihydrate Solution 0.5M
Used as Analytical reagent.
n-Butyl acetate, Semiconductor Grade, 99% min
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Benzyl L-lactate, 97%
CAS: 56777-24-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00209546 InChI Key: ZYTLPUIDJRKAAM-QMMMGPOBSA-N Synonym: benzyl s---lactate,benzyl l-lactate,benzyl s-lactate,s---lactic acid benzyl ester,benzyl 2s-2-hydroxypropanoate,benzyl-l-lactate,s-benzyllactate,s-benzyl lactate,s-lactic acid benzyl ester,2s-lactic acid benzyl ester PubChem CID: 11052238 IUPAC Name: benzyl (2S)-2-hydroxypropanoate SMILES: CC(C(=O)OCC1=CC=CC=C1)O
| PubChem CID | 11052238 |
|---|---|
| CAS | 56777-24-3 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00209546 |
| SMILES | CC(C(=O)OCC1=CC=CC=C1)O |
| Synonym | benzyl s---lactate,benzyl l-lactate,benzyl s-lactate,s---lactic acid benzyl ester,benzyl 2s-2-hydroxypropanoate,benzyl-l-lactate,s-benzyllactate,s-benzyl lactate,s-lactic acid benzyl ester,2s-lactic acid benzyl ester |
| IUPAC Name | benzyl (2S)-2-hydroxypropanoate |
| InChI Key | ZYTLPUIDJRKAAM-QMMMGPOBSA-N |
| Molecular Formula | C10H12O3 |
Potassium formate, 96%, pract.
CAS: 590-29-4 Molecular Formula: CHKO2 Molecular Weight (g/mol): 84.12 MDL Number: MFCD00013100 InChI Key: WFIZEGIEIOHZCP-UHFFFAOYSA-M Synonym: potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent PubChem CID: 2735122 ChEBI: CHEBI:63316 IUPAC Name: potassium;formate SMILES: C(=O)[O-].[K+]
| PubChem CID | 2735122 |
|---|---|
| CAS | 590-29-4 |
| Molecular Weight (g/mol) | 84.12 |
| ChEBI | CHEBI:63316 |
| MDL Number | MFCD00013100 |
| SMILES | C(=O)[O-].[K+] |
| Synonym | potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent |
| IUPAC Name | potassium;formate |
| InChI Key | WFIZEGIEIOHZCP-UHFFFAOYSA-M |
| Molecular Formula | CHKO2 |
Tributyl citrate, 99+%
CAS: 77-94-1 Molecular Formula: C18H32O7 Molecular Weight (g/mol): 360.45 MDL Number: MFCD00027217 InChI Key: ZFOZVQLOBQUTQQ-UHFFFAOYSA-N Synonym: tributyl citrate,butyl citrate,tri-n-butyl citrate,n-butyl citrate,citroflex 4,citric acid, tributyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, tributyl ester,butyl citrate van,unii-827d5b1b6s,2-hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester PubChem CID: 6507 IUPAC Name: tributyl 2-hydroxypropane-1,2,3-tricarboxylate SMILES: CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC
| PubChem CID | 6507 |
|---|---|
| CAS | 77-94-1 |
| Molecular Weight (g/mol) | 360.45 |
| MDL Number | MFCD00027217 |
| SMILES | CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC |
| Synonym | tributyl citrate,butyl citrate,tri-n-butyl citrate,n-butyl citrate,citroflex 4,citric acid, tributyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, tributyl ester,butyl citrate van,unii-827d5b1b6s,2-hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester |
| IUPAC Name | tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | ZFOZVQLOBQUTQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H32O7 |
Diethyl fumarate, 98%
CAS: 623-91-6 Molecular Formula: C8H12O4 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00064455 InChI Key: IEPRKVQEAMIZSS-AATRIKPKSA-N Synonym: diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a PubChem CID: 638144 ChEBI: CHEBI:87388 IUPAC Name: diethyl (E)-but-2-enedioate SMILES: CCOC(=O)\C=C\C(=O)OCC
| PubChem CID | 638144 |
|---|---|
| CAS | 623-91-6 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:87388 |
| MDL Number | MFCD00064455 |
| SMILES | CCOC(=O)\C=C\C(=O)OCC |
| Synonym | diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a |
| IUPAC Name | diethyl (E)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-AATRIKPKSA-N |
| Molecular Formula | C8H12O4 |
Methyl benzoate, 99%
CAS: 93-58-3 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 InChI Key: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC Name: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| PubChem CID | 7150 |
|---|---|
| CAS | 93-58-3 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:72775 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| IUPAC Name | methyl benzoate |
| InChI Key | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Propyl gallate, 98%
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.2 MDL Number: MFCD00002196 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N Synonym: propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate PubChem CID: 4947 ChEBI: CHEBI:10607 IUPAC Name: propyl 3,4,5-trihydroxybenzoate SMILES: CCCOC(=O)C1=CC(=C(C(=C1)O)O)O
| PubChem CID | 4947 |
|---|---|
| CAS | 121-79-9 |
| Molecular Weight (g/mol) | 212.2 |
| ChEBI | CHEBI:10607 |
| MDL Number | MFCD00002196 |
| SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Synonym | propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
4-Phenylbutyric acid, 99%
CAS: 1821-12-1 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.2 InChI Key: OBKXEAXTFZPCHS-UHFFFAOYSA-N Synonym: 4-phenylbutyric acid,benzenebutanoic acid,benzenebutyric acid,phenylbutyrate,gamma-phenylbutyric acid,omega-phenylbutanoic acid,phenylbutyric acid,4-phenylbutyrate,butyric acid, 4-phenyl,4-phenyl-n-butyric acid PubChem CID: 4775 ChEBI: CHEBI:41500 IUPAC Name: 4-phenylbutanoic acid SMILES: C1=CC=C(C=C1)CCCC(=O)O
| PubChem CID | 4775 |
|---|---|
| CAS | 1821-12-1 |
| Molecular Weight (g/mol) | 164.2 |
| ChEBI | CHEBI:41500 |
| SMILES | C1=CC=C(C=C1)CCCC(=O)O |
| Synonym | 4-phenylbutyric acid,benzenebutanoic acid,benzenebutyric acid,phenylbutyrate,gamma-phenylbutyric acid,omega-phenylbutanoic acid,phenylbutyric acid,4-phenylbutyrate,butyric acid, 4-phenyl,4-phenyl-n-butyric acid |
| IUPAC Name | 4-phenylbutanoic acid |
| InChI Key | OBKXEAXTFZPCHS-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
Ethylenediamine tetraacetic acid disodium salt dihydrate, 99.74%, MP Biomedicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Magnesium Di Citrate, MP Biomedicals
CAS: 3344-18-1 Molecular Formula: C12H12Mg3O15 Molecular Weight (g/mol): 469.128 InChI Key: HZTVQLXIRHEMMB-UHFFFAOYSA-H Synonym: trimagnesium 2+ dicitrate hydrate PubChem CID: 122198783 IUPAC Name: trimagnesium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[Mg+2].[Mg+2].[Mg+2]
| PubChem CID | 122198783 |
|---|---|
| CAS | 3344-18-1 |
| Molecular Weight (g/mol) | 469.128 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[Mg+2].[Mg+2].[Mg+2] |
| Synonym | trimagnesium 2+ dicitrate hydrate |
| IUPAC Name | trimagnesium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | HZTVQLXIRHEMMB-UHFFFAOYSA-H |
| Molecular Formula | C12H12Mg3O15 |
n-Propyl Gallate, MP Biomedicals™
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.2 MDL Number: MFCD00002196 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N
| CAS | 121-79-9 |
|---|---|
| Molecular Weight (g/mol) | 212.2 |
| MDL Number | MFCD00002196 |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
N-Propyl Gallate MP Biomedicals
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.201 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N Synonym: propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate PubChem CID: 4947 ChEBI: CHEBI:10607 IUPAC Name: propyl 3,4,5-trihydroxybenzoate
| PubChem CID | 4947 |
|---|---|
| CAS | 121-79-9 |
| Molecular Weight (g/mol) | 212.201 |
| ChEBI | CHEBI:10607 |
| Synonym | propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
EDTA, Sodium Ferric Salt, MP Biomedicals
CAS: 15708-41-5 Molecular Formula: C10H12FeN2NaO8 Molecular Weight (g/mol): 367.047 InChI Key: MKWYFZFMAMBPQK-UHFFFAOYSA-J Synonym: sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta PubChem CID: 27461 ChEBI: CHEBI:78292 IUPAC Name: sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3]
| PubChem CID | 27461 |
|---|---|
| CAS | 15708-41-5 |
| Molecular Weight (g/mol) | 367.047 |
| ChEBI | CHEBI:78292 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
| Synonym | sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta |
| IUPAC Name | sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| InChI Key | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| Molecular Formula | C10H12FeN2NaO8 |